About CID 88987904
CID 88987904 (PubChem CID 88987904) has the molecular formula C32H20BBrN4
and a molecular weight of 551.26 g/mol.
Molecular Properties
| Compound Name | CID 88987904 |
| PubChem CID | 88987904 |
| Molecular Formula | C32H20BBrN4 |
| Molecular Weight | 551.26 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(-c2cc(-c3ccccn3)nc(-c3cc(-c4cccc(Br)c4)cc(-c4ccccn4)n3)c2)c1 |
| InChI | InChI=1S/C32H20BBrN4/c33-25-9-5-7-21(15-25)23-17-29(27-11-1-3-13-35-27)37-31(19-23)32-20-24(22-8-6-10-26(34)16-22)18-30(38-32)28-12-2-4-14-36-28/h1-20H |
| InChIKey | CUOCPBPKDXZZOQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.26 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88987904 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88987904?
The IUPAC name of CID 88987904 (CID 88987904) is not available.
What is the SMILES notation for CID 88987904?
The canonical SMILES for CID 88987904 is [B]c1cccc(-c2cc(-c3ccccn3)nc(-c3cc(-c4cccc(Br)c4)cc(-c4ccccn4)n3)c2)c1.
What is the InChIKey of CID 88987904?
The InChIKey is CUOCPBPKDXZZOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H20BBrN4/c33-25-9-5-7-21(15-25)23-17-29(27-11-1-3-13-35-27)37-31(19-23)32-20-24(22-8-6-10-26(34)16-22)18-30(38-32)28-12-2-4-14-36-28/h1-20H.
What are the key properties of CID 88987904?
CID 88987904 has a molecular weight of 551.26 g/mol, XLogP of 7.16, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88987904 is sourced from PubChem (CID 88987904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).