C25H33F8NO2 — CID 88988059
1-[(2S,4S)-3,3-difluoro-2-hydroxy-1-[(4R)-1,1,1-trifluoro-7,7-dimethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one (PubChem CID 88988059) has the molecular formula C25H33F8NO2 and a molecular weight of 531.53 g/mol. Its IUPAC name is 1-[(2S,4S)-3,3-difluoro-2-hydroxy-1-[(4R)-1,1,1-trifluoro-7,7-dimethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one.
| Compound Name | 1-[(2S,4S)-3,3-difluoro-2-hydroxy-1-[(4R)-1,1,1-trifluoro-7,7-dimethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one |
|---|---|
| PubChem CID | 88988059 |
| Molecular Formula | C25H33F8NO2 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 1-[(2S,4S)-3,3-difluoro-2-hydroxy-1-[(4R)-1,1,1-trifluoro-7,7-dimethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1CCN([C@H](CCC(C)(C)C)CCC(F)(F)F)[C@](O)(c2ccc(C(F)(F)F)cc2)C1(F)F |
| InChI | InChI=1S/C25H33F8NO2/c1-16(35)15-19-11-14-34(20(9-12-21(2,3)4)10-13-22(26,27)28)24(36,23(19,29)30)17-5-7-18(8-6-17)25(31,32)33/h5-8,19-20,36H,9-15H2,1-4H3/t19-,20+,24-/m0/s1 |
| InChIKey | HRIMOUHOFRWPLU-ROKPMTFOSA-N |
| XLogP | 7.32 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |