About 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole
2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole (PubChem CID 88988085) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole.
Molecular Properties
| Compound Name | 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole |
| PubChem CID | 88988085 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole |
| SMILES | CC1=C(N2C=CCN2C)C=CCC1 |
| InChI | InChI=1S/C11H16N2/c1-10-6-3-4-7-11(10)13-9-5-8-12(13)2/h4-5,7,9H,3,6,8H2,1-2H3 |
| InChIKey | KQYXSFLWTXKZLK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole?
The IUPAC name of 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole (CID 88988085) is 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole.
What is the SMILES notation for 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole?
The canonical SMILES for 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole is CC1=C(N2C=CCN2C)C=CCC1.
What is the InChIKey of 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole?
The InChIKey is KQYXSFLWTXKZLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-10-6-3-4-7-11(10)13-9-5-8-12(13)2/h4-5,7,9H,3,6,8H2,1-2H3.
What are the key properties of 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole?
2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole has a molecular weight of 176.26 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2-methylcyclohexa-1,5-dien-1-yl)-3H-pyrazole is sourced from PubChem (CID 88988085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).