C31H36O4 — CID 88988174
[(1R,12R,16R,19S,21S)-19-hydroxy-12-propyl-22-oxahexacyclo[12.8.0.01,21.04,13.05,10.016,21]docosa-5(10),6,8-trien-8-yl] benzoate (PubChem CID 88988174) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is [(1R,12R,16R,19S,21S)-19-hydroxy-12-propyl-22-oxahexacyclo[12.8.0.01,21.04,13.05,10.016,21]docosa-5(10),6,8-trien-8-yl] benzoate.
| Compound Name | [(1R,12R,16R,19S,21S)-19-hydroxy-12-propyl-22-oxahexacyclo[12.8.0.01,21.04,13.05,10.016,21]docosa-5(10),6,8-trien-8-yl] benzoate |
|---|---|
| PubChem CID | 88988174 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [(1R,12R,16R,19S,21S)-19-hydroxy-12-propyl-22-oxahexacyclo[12.8.0.01,21.04,13.05,10.016,21]docosa-5(10),6,8-trien-8-yl] benzoate |
| SMILES | CCCC1Cc2cc(OC(=O)c3ccccc3)ccc2C2CC[C@]34O[C@]35C[C@@H](O)CC[C@@H]5CC4C12 |
| InChI | InChI=1S/C31H36O4/c1-2-6-20-15-21-16-24(34-29(33)19-7-4-3-5-8-19)11-12-25(21)26-13-14-30-27(28(20)26)17-22-9-10-23(32)18-31(22,30)35-30/h3-5,7-8,11-12,16,20,22-23,26-28,32H,2,6,9-10,13-15,17-18H2,1H3/t20?,22-,23+,26?,27?,28?,30-,31+/m1/s1 |
| InChIKey | DIWXMJCJSRVLEC-JWVWBENGSA-N |
| XLogP | 6.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|