C9H13ClF3N — CID 88988239
(3Z,5Z)-4-chloro-8,8,8-trifluoro-5-methylocta-3,5-dien-3-amine (PubChem CID 88988239) has the molecular formula C9H13ClF3N and a molecular weight of 227.66 g/mol. Its IUPAC name is (3Z,5Z)-4-chloro-8,8,8-trifluoro-5-methylocta-3,5-dien-3-amine.
| Compound Name | (3Z,5Z)-4-chloro-8,8,8-trifluoro-5-methylocta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 88988239 |
| Molecular Formula | C9H13ClF3N |
| Molecular Weight | 227.66 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3Z,5Z)-4-chloro-8,8,8-trifluoro-5-methylocta-3,5-dien-3-amine |
| SMILES | CC/C(N)=C(Cl)\C(C)=C/CC(F)(F)F |
| InChI | InChI=1S/C9H13ClF3N/c1-3-7(14)8(10)6(2)4-5-9(11,12)13/h4H,3,5,14H2,1-2H3/b6-4-,8-7- |
| InChIKey | OXURRNQEFVHPDI-MOIRPGTBSA-N |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|