C19H21NO7 — CID 88988276
7-[[(3aS,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one (PubChem CID 88988276) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is 7-[[(3aS,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one.
| Compound Name | 7-[[(3aS,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one |
|---|---|
| PubChem CID | 88988276 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 7-[[(3aS,7R,7aS)-6,6,7-trimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one |
| SMILES | CNc1cc2ccc(OC3OC(C)(C)[C@H](C)[C@@H]4OC(=O)O[C@H]34)cc2oc1=O |
| InChI | InChI=1S/C19H21NO7/c1-9-14-15(26-18(22)25-14)17(27-19(9,2)3)23-11-6-5-10-7-12(20-4)16(21)24-13(10)8-11/h5-9,14-15,17,20H,1-4H3/t9-,14+,15+,17?/m1/s1 |
| InChIKey | DYIQRPAWROZWQC-PEVSJUHKSA-N |
| XLogP | 2.89 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|