C25H27N5O2 — CID 88988613
10-[2-(2-benzylpyrrolidin-1-yl)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 88988613) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 10-[2-(2-benzylpyrrolidin-1-yl)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[2-(2-benzylpyrrolidin-1-yl)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 88988613 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 10-[2-(2-benzylpyrrolidin-1-yl)ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCN3CCCC3Cc3ccccc3)c2cc1C |
| InChI | InChI=1S/C25H27N5O2/c1-16-13-20-21(14-17(16)2)30(23-22(26-20)24(31)28-25(32)27-23)12-11-29-10-6-9-19(29)15-18-7-4-3-5-8-18/h3-5,7-8,13-14,19H,6,9-12,15H2,1-2H3,(H,28,31,32) |
| InChIKey | LEWSIDQYBLUMJB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|