C20H22N6O4 — CID 88988617
10-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 88988617) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 10-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 88988617 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 10-[5-(2,5-dioxoimidazolidin-1-yl)pentyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCCN3C(=O)CNC3=O)c2cc1C |
| InChI | InChI=1S/C20H22N6O4/c1-11-8-13-14(9-12(11)2)25(17-16(22-13)18(28)24-19(29)23-17)6-4-3-5-7-26-15(27)10-21-20(26)30/h8-9H,3-7,10H2,1-2H3,(H,21,30)(H,24,28,29) |
| InChIKey | OXRGIFGXEVEXRC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|