C20H23N5O4 — CID 88988677
(2S)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]piperidine-2-carboxylic acid (PubChem CID 88988677) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is (2S)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88988677 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCN3CCCC[C@H]3C(=O)O)c2cc1C |
| InChI | InChI=1S/C20H23N5O4/c1-11-9-13-15(10-12(11)2)25(17-16(21-13)18(26)23-20(29)22-17)8-7-24-6-4-3-5-14(24)19(27)28/h9-10,14H,3-8H2,1-2H3,(H,27,28)(H,23,26,29)/t14-/m0/s1 |
| InChIKey | SWGIYFOYEBXYMR-AWEZNQCLSA-N |
| XLogP | 1.14 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|