About [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate
[4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate (PubChem CID 88988973) has the molecular formula C14H12F2N2O3
and a molecular weight of 294.26 g/mol. Its IUPAC name is [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate.
Molecular Properties
| Compound Name | [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate |
| PubChem CID | 88988973 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate |
| SMILES | CC(=O)Oc1c(F)cc(/C=C2\N=C(C)N(C)C2=O)cc1F |
| InChI | InChI=1S/C14H12F2N2O3/c1-7-17-12(14(20)18(7)3)6-9-4-10(15)13(11(16)5-9)21-8(2)19/h4-6H,1-3H3/b12-6- |
| InChIKey | XHUOZYOQFFEPAA-SDQBBNPISA-N |
| XLogP | 2.12 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate?
The IUPAC name of [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate (CID 88988973) is [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate.
What is the SMILES notation for [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate?
The canonical SMILES for [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate is CC(=O)Oc1c(F)cc(/C=C2\N=C(C)N(C)C2=O)cc1F.
What is the InChIKey of [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate?
The InChIKey is XHUOZYOQFFEPAA-SDQBBNPISA-N. The full InChI is InChI=1S/C14H12F2N2O3/c1-7-17-12(14(20)18(7)3)6-9-4-10(15)13(11(16)5-9)21-8(2)19/h4-6H,1-3H3/b12-6-.
What are the key properties of [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate?
[4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate has a molecular weight of 294.26 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(Z)-(1,2-dimethyl-5-oxoimidazol-4-ylidene)methyl]-2,6-difluorophenyl] acetate is sourced from PubChem (CID 88988973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).