C9H14N2O — CID 88989745
(2E,3Z,5Z)-2-ethylidene-N'-hydroxyhepta-3,5-dienimidamide (PubChem CID 88989745) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,3Z,5Z)-2-ethylidene-N'-hydroxyhepta-3,5-dienimidamide.
| Compound Name | (2E,3Z,5Z)-2-ethylidene-N'-hydroxyhepta-3,5-dienimidamide |
|---|---|
| PubChem CID | 88989745 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (2E,3Z,5Z)-2-ethylidene-N'-hydroxyhepta-3,5-dienimidamide |
| SMILES | C/C=C\C=C/C(=C\C)/C(N)=N/O |
| InChI | InChI=1S/C9H14N2O/c1-3-5-6-7-8(4-2)9(10)11-12/h3-7,12H,1-2H3,(H2,10,11)/b5-3-,7-6-,8-4+ |
| InChIKey | XEBGMLYHJJQWNN-QFRJOCIQSA-N |
| XLogP | 1.81 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|