C11H13F5 — CID 88990011
1-methyl-4-(3,3,4,4,4-pentafluorobutyl)cyclohexa-1,3-diene (PubChem CID 88990011) has the molecular formula C11H13F5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1-methyl-4-(3,3,4,4,4-pentafluorobutyl)cyclohexa-1,3-diene.
| Compound Name | 1-methyl-4-(3,3,4,4,4-pentafluorobutyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88990011 |
| Molecular Formula | C11H13F5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-methyl-4-(3,3,4,4,4-pentafluorobutyl)cyclohexa-1,3-diene |
| SMILES | CC1=CC=C(CCC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H13F5/c1-8-2-4-9(5-3-8)6-7-10(12,13)11(14,15)16/h2,4H,3,5-7H2,1H3 |
| InChIKey | KEDQKMUYTYRXFW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|