C12H16O2 — CID 88990123
3-hydroxy-2-propyl-2,3,3a,7a-tetrahydroinden-1-one (PubChem CID 88990123) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-hydroxy-2-propyl-2,3,3a,7a-tetrahydroinden-1-one.
| Compound Name | 3-hydroxy-2-propyl-2,3,3a,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 88990123 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-hydroxy-2-propyl-2,3,3a,7a-tetrahydroinden-1-one |
| SMILES | CCCC1C(=O)C2C=CC=CC2C1O |
| InChI | InChI=1S/C12H16O2/c1-2-5-10-11(13)8-6-3-4-7-9(8)12(10)14/h3-4,6-11,13H,2,5H2,1H3 |
| InChIKey | UJHAIVJYWZZGCG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |