C19H22N2O4 — CID 88990232
(2S,4R)-4-(6-ethenyl-2-ethoxy-7-methoxyquinolin-4-yl)oxypyrrolidine-2-carbaldehyde (PubChem CID 88990232) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2S,4R)-4-(6-ethenyl-2-ethoxy-7-methoxyquinolin-4-yl)oxypyrrolidine-2-carbaldehyde.
| Compound Name | (2S,4R)-4-(6-ethenyl-2-ethoxy-7-methoxyquinolin-4-yl)oxypyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 88990232 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2S,4R)-4-(6-ethenyl-2-ethoxy-7-methoxyquinolin-4-yl)oxypyrrolidine-2-carbaldehyde |
| SMILES | C=Cc1cc2c(O[C@H]3CN[C@H](C=O)C3)cc(OCC)nc2cc1OC |
| InChI | InChI=1S/C19H22N2O4/c1-4-12-6-15-16(8-17(12)23-3)21-19(24-5-2)9-18(15)25-14-7-13(11-22)20-10-14/h4,6,8-9,11,13-14,20H,1,5,7,10H2,2-3H3/t13-,14+/m0/s1 |
| InChIKey | KQFLJHRRYDLQDH-UONOGXRCSA-N |
| XLogP | 2.59 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|