C9H10N4 — CID 88990244
N,2-dimethylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 88990244) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is N,2-dimethylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N,2-dimethylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 88990244 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | N,2-dimethylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc2cnccc12 |
| InChI | InChI=1S/C9H10N4/c1-6-12-8-5-11-4-3-7(8)9(10-2)13-6/h3-5H,1-2H3,(H,10,12,13) |
| InChIKey | ULQGOEIGAZAAQM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |