About 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile
8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile (PubChem CID 88990267) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile |
| PubChem CID | 88990267 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile |
| SMILES | CC1CC2CC1C1C(=O)OC(C#N)C21 |
| InChI | InChI=1S/C11H13NO2/c1-5-2-6-3-7(5)10-9(6)8(4-12)14-11(10)13/h5-10H,2-3H2,1H3 |
| InChIKey | IKELWODYPBMUOK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile?
The IUPAC name of 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile (CID 88990267) is 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile.
What is the SMILES notation for 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile?
The canonical SMILES for 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile is CC1CC2CC1C1C(=O)OC(C#N)C21.
What is the InChIKey of 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile?
The InChIKey is IKELWODYPBMUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-5-2-6-3-7(5)10-9(6)8(4-12)14-11(10)13/h5-10H,2-3H2,1H3.
What are the key properties of 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile?
8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile has a molecular weight of 191.23 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5-oxo-4-oxatricyclo[5.2.1.02,6]decane-3-carbonitrile is sourced from PubChem (CID 88990267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).