About 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene
2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene (PubChem CID 88990348) has the molecular formula C16H15F6N2O2P
and a molecular weight of 412.27 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene |
| PubChem CID | 88990348 |
| Molecular Formula | C16H15F6N2O2P |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(P(N)N)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6N2O2P/c1-25-11-3-4-12(26-2)14(27(23)24)13(11)8-5-9(15(17,18)19)7-10(6-8)16(20,21)22/h3-7H,23-24H2,1-2H3 |
| InChIKey | TWEQYQPSBWWIQZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene (CID 88990348) is 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene is COc1ccc(OC)c(P(N)N)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene?
The InChIKey is TWEQYQPSBWWIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F6N2O2P/c1-25-11-3-4-12(26-2)14(27(23)24)13(11)8-5-9(15(17,18)19)7-10(6-8)16(20,21)22/h3-7H,23-24H2,1-2H3.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene?
2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene has a molecular weight of 412.27 g/mol, XLogP of 4.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]-3-diaminophosphanyl-1,4-dimethoxybenzene is sourced from PubChem (CID 88990348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).