About 4a,5-dihydroquinolin-8-amine
4a,5-dihydroquinolin-8-amine (PubChem CID 88990594) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 4a,5-dihydroquinolin-8-amine.
Molecular Properties
| Compound Name | 4a,5-dihydroquinolin-8-amine |
| PubChem CID | 88990594 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 4a,5-dihydroquinolin-8-amine |
| SMILES | NC1=C2N=CC=CC2CC=C1 |
| InChI | InChI=1S/C9H10N2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-7H,3,10H2 |
| InChIKey | UVCIWVYNHOZOHI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4a,5-dihydroquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5-dihydroquinolin-8-amine?
The IUPAC name of 4a,5-dihydroquinolin-8-amine (CID 88990594) is 4a,5-dihydroquinolin-8-amine.
What is the SMILES notation for 4a,5-dihydroquinolin-8-amine?
The canonical SMILES for 4a,5-dihydroquinolin-8-amine is NC1=C2N=CC=CC2CC=C1.
What is the InChIKey of 4a,5-dihydroquinolin-8-amine?
The InChIKey is UVCIWVYNHOZOHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-7H,3,10H2.
What are the key properties of 4a,5-dihydroquinolin-8-amine?
4a,5-dihydroquinolin-8-amine has a molecular weight of 146.19 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5-dihydroquinolin-8-amine is sourced from PubChem (CID 88990594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).