C18H22F2O4 — CID 88990933
1-[4-[difluoro(prop-1-en-2-yloxy)methyl]phenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 88990933) has the molecular formula C18H22F2O4 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-[4-[difluoro(prop-1-en-2-yloxy)methyl]phenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[difluoro(prop-1-en-2-yloxy)methyl]phenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 88990933 |
| Molecular Formula | C18H22F2O4 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[4-[difluoro(prop-1-en-2-yloxy)methyl]phenyl]-4-propyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | C=C(C)OC(F)(F)c1ccc(C23OCC(CCC)(CO2)CO3)cc1 |
| InChI | InChI=1S/C18H22F2O4/c1-4-9-16-10-21-18(22-11-16,23-12-16)15-7-5-14(6-8-15)17(19,20)24-13(2)3/h5-8H,2,4,9-12H2,1,3H3 |
| InChIKey | FNFLFDUEDFJRCU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|