C34H34F6O3 — CID 88990954
1-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 88990954) has the molecular formula C34H34F6O3 and a molecular weight of 604.63 g/mol. Its IUPAC name is 1-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 88990954 |
| Molecular Formula | C34H34F6O3 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 1-[4-[4-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorophenyl]cyclohexyl]-4-pentyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CCCCCC12COC(C3CCC(c4ccc(-c5cc(F)c(-c6cc(F)c(F)c(F)c6)c(F)c5)c(F)c4)CC3)(OC1)OC2 |
| InChI | InChI=1S/C34H34F6O3/c1-2-3-4-11-33-17-41-34(42-18-33,43-19-33)24-8-5-20(6-9-24)21-7-10-25(26(35)12-21)22-13-27(36)31(28(37)14-22)23-15-29(38)32(40)30(39)16-23/h7,10,12-16,20,24H,2-6,8-9,11,17-19H2,1H3 |
| InChIKey | QFKGBCLJFOZHJS-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|