C15H25NO2 — CID 88991126
(2E,4E)-3-methyl-N-(oxolan-2-ylmethyl)nona-2,4-dienamide (PubChem CID 88991126) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (2E,4E)-3-methyl-N-(oxolan-2-ylmethyl)nona-2,4-dienamide.
| Compound Name | (2E,4E)-3-methyl-N-(oxolan-2-ylmethyl)nona-2,4-dienamide |
|---|---|
| PubChem CID | 88991126 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (2E,4E)-3-methyl-N-(oxolan-2-ylmethyl)nona-2,4-dienamide |
| SMILES | CCCC/C=C/C(C)=C/C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C15H25NO2/c1-3-4-5-6-8-13(2)11-15(17)16-12-14-9-7-10-18-14/h6,8,11,14H,3-5,7,9-10,12H2,1-2H3,(H,16,17)/b8-6+,13-11+ |
| InChIKey | XUQSHVKPPWVLSW-VAFZVJGJSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|