C15H23NO2 — CID 88991133
(2E,4E)-N-(oxan-4-ylmethyl)nona-2,4,8-trienamide (PubChem CID 88991133) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2E,4E)-N-(oxan-4-ylmethyl)nona-2,4,8-trienamide.
| Compound Name | (2E,4E)-N-(oxan-4-ylmethyl)nona-2,4,8-trienamide |
|---|---|
| PubChem CID | 88991133 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2E,4E)-N-(oxan-4-ylmethyl)nona-2,4,8-trienamide |
| SMILES | C=CCC/C=C/C=C/C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-6-7-8-15(17)16-13-14-9-11-18-12-10-14/h2,5-8,14H,1,3-4,9-13H2,(H,16,17)/b6-5+,8-7+ |
| InChIKey | BKOJUHBBQAPNNC-BSWSSELBSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|