C21H25N3O4 — CID 8899153
N'-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 8899153) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N'-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 8899153 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N'-[(Z)-(2,4-diethoxyphenyl)methylideneamino]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)C(=O)NCc2ccc(C)cc2)c(OCC)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-4-27-18-11-10-17(19(12-18)28-5-2)14-23-24-21(26)20(25)22-13-16-8-6-15(3)7-9-16/h6-12,14H,4-5,13H2,1-3H3,(H,22,25)(H,24,26)/b23-14- |
| InChIKey | GUWSYNMDNLTEII-UCQKPKSFSA-N |
| XLogP | 2.56 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|