About N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide
N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide (PubChem CID 88991651) has the molecular formula C10H23NO6S
and a molecular weight of 285.36 g/mol. Its IUPAC name is N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide |
| PubChem CID | 88991651 |
| Molecular Formula | C10H23NO6S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide |
| SMILES | CC(C)OC(CNS(C)(=O)=O)COCC(O)CO |
| InChI | InChI=1S/C10H23NO6S/c1-8(2)17-10(4-11-18(3,14)15)7-16-6-9(13)5-12/h8-13H,4-7H2,1-3H3 |
| InChIKey | HZJWHWKSBHTGBZ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide?
The IUPAC name of N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide (CID 88991651) is N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide.
What is the SMILES notation for N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide?
The canonical SMILES for N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide is CC(C)OC(CNS(C)(=O)=O)COCC(O)CO.
What is the InChIKey of N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide?
The InChIKey is HZJWHWKSBHTGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO6S/c1-8(2)17-10(4-11-18(3,14)15)7-16-6-9(13)5-12/h8-13H,4-7H2,1-3H3.
What are the key properties of N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide?
N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide has a molecular weight of 285.36 g/mol, XLogP of -1.30, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,3-dihydroxypropoxy)-2-propan-2-yloxypropyl]methanesulfonamide is sourced from PubChem (CID 88991651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).