About N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide
N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide (PubChem CID 88991668) has the molecular formula C12H26F2N2O2S
and a molecular weight of 300.41 g/mol. Its IUPAC name is N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide |
| PubChem CID | 88991668 |
| Molecular Formula | C12H26F2N2O2S |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide |
| SMILES | CC(C)N(CCN(C(C)(C)C)S(C)(=O)=O)CC(F)F |
| InChI | InChI=1S/C12H26F2N2O2S/c1-10(2)15(9-11(13)14)7-8-16(12(3,4)5)19(6,17)18/h10-11H,7-9H2,1-6H3 |
| InChIKey | MMAULCDQVIHNDD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide?
The IUPAC name of N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide (CID 88991668) is N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide.
What is the SMILES notation for N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide?
The canonical SMILES for N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide is CC(C)N(CCN(C(C)(C)C)S(C)(=O)=O)CC(F)F.
What is the InChIKey of N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide?
The InChIKey is MMAULCDQVIHNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26F2N2O2S/c1-10(2)15(9-11(13)14)7-8-16(12(3,4)5)19(6,17)18/h10-11H,7-9H2,1-6H3.
What are the key properties of N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide?
N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide has a molecular weight of 300.41 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[2-[2,2-difluoroethyl(propan-2-yl)amino]ethyl]methanesulfonamide is sourced from PubChem (CID 88991668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).