About 5-cyclopropyl-1,4-dimethylpyrazole
5-cyclopropyl-1,4-dimethylpyrazole (PubChem CID 88991708) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-cyclopropyl-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-cyclopropyl-1,4-dimethylpyrazole |
| PubChem CID | 88991708 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5-cyclopropyl-1,4-dimethylpyrazole |
| SMILES | Cc1cnn(C)c1C1CC1 |
| InChI | InChI=1S/C8H12N2/c1-6-5-9-10(2)8(6)7-3-4-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | HVTAYPKXSYSZQY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopropyl-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-1,4-dimethylpyrazole?
The IUPAC name of 5-cyclopropyl-1,4-dimethylpyrazole (CID 88991708) is 5-cyclopropyl-1,4-dimethylpyrazole.
What is the SMILES notation for 5-cyclopropyl-1,4-dimethylpyrazole?
The canonical SMILES for 5-cyclopropyl-1,4-dimethylpyrazole is Cc1cnn(C)c1C1CC1.
What is the InChIKey of 5-cyclopropyl-1,4-dimethylpyrazole?
The InChIKey is HVTAYPKXSYSZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-5-9-10(2)8(6)7-3-4-7/h5,7H,3-4H2,1-2H3.
What are the key properties of 5-cyclopropyl-1,4-dimethylpyrazole?
5-cyclopropyl-1,4-dimethylpyrazole has a molecular weight of 136.20 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1,4-dimethylpyrazole is sourced from PubChem (CID 88991708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).