About N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide
N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide (PubChem CID 88991754) has the molecular formula C10H21NO2S
and a molecular weight of 219.35 g/mol. Its IUPAC name is N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide |
| PubChem CID | 88991754 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide |
| SMILES | CN(CC/C=C\C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C10H21NO2S/c1-10(2,3)8-6-7-9-11(4)14(5,12)13/h6,8H,7,9H2,1-5H3/b8-6- |
| InChIKey | GSWZMNWPWXYKCK-VURMDHGXSA-N |
| XLogP | 1.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide (CID 88991754) is N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide is CN(CC/C=C\C(C)(C)C)S(C)(=O)=O.
What is the InChIKey of N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide?
The InChIKey is GSWZMNWPWXYKCK-VURMDHGXSA-N. The full InChI is InChI=1S/C10H21NO2S/c1-10(2,3)8-6-7-9-11(4)14(5,12)13/h6,8H,7,9H2,1-5H3/b8-6-.
What are the key properties of N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide?
N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide has a molecular weight of 219.35 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-5,5-dimethylhex-3-enyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 88991754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).