C28H47N — CID 88991799
1-cyclohex-2-en-1-yl-6-[(4R,5S)-4,5-dimethylhept-1-en-2-yl]-3-pent-4-enyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 88991799) has the molecular formula C28H47N and a molecular weight of 397.69 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-6-[(4R,5S)-4,5-dimethylhept-1-en-2-yl]-3-pent-4-enyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-cyclohex-2-en-1-yl-6-[(4R,5S)-4,5-dimethylhept-1-en-2-yl]-3-pent-4-enyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 88991799 |
| Molecular Formula | C28H47N |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.37 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-6-[(4R,5S)-4,5-dimethylhept-1-en-2-yl]-3-pent-4-enyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | C=CCCCC1CN(C2C=CCCC2)C2CC(C(=C)C[C@@H](C)[C@@H](C)CC)CCC12 |
| InChI | InChI=1S/C28H47N/c1-6-8-10-13-25-20-29(26-14-11-9-12-15-26)28-19-24(16-17-27(25)28)23(5)18-22(4)21(3)7-2/h6,11,14,21-22,24-28H,1,5,7-10,12-13,15-20H2,2-4H3/t21-,22+,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | WKTPSUAGPXUNGE-LMFDPABNSA-N |
| XLogP | 7.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|