About (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide
(2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide (PubChem CID 88991997) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide.
Molecular Properties
| Compound Name | (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide |
| PubChem CID | 88991997 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide |
| SMILES | C/C=C(\C)CNC(=O)[C@H](C)C(C)(C)CC |
| InChI | InChI=1S/C13H25NO/c1-7-10(3)9-14-12(15)11(4)13(5,6)8-2/h7,11H,8-9H2,1-6H3,(H,14,15)/b10-7+/t11-/m0/s1 |
| InChIKey | KBEPDGRFOVZRRF-HUYFXPKMSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide?
The IUPAC name of (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide (CID 88991997) is (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide.
What is the SMILES notation for (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide?
The canonical SMILES for (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide is C/C=C(\C)CNC(=O)[C@H](C)C(C)(C)CC.
What is the InChIKey of (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide?
The InChIKey is KBEPDGRFOVZRRF-HUYFXPKMSA-N. The full InChI is InChI=1S/C13H25NO/c1-7-10(3)9-14-12(15)11(4)13(5,6)8-2/h7,11H,8-9H2,1-6H3,(H,14,15)/b10-7+/t11-/m0/s1.
What are the key properties of (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide?
(2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide has a molecular weight of 211.35 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3,3-trimethyl-N-[(E)-2-methylbut-2-enyl]pentanamide is sourced from PubChem (CID 88991997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).