C29H42N2 — CID 88992140
(9E)-4-cyclohexa-1,3-dien-1-yl-9-cyclohexa-1,5-dien-1-yl-2-methyl-11-methylimino-8-[(Z)-prop-1-enyl]dodeca-1,9-dien-6-amine (PubChem CID 88992140) has the molecular formula C29H42N2 and a molecular weight of 418.67 g/mol. Its IUPAC name is (9E)-4-cyclohexa-1,3-dien-1-yl-9-cyclohexa-1,5-dien-1-yl-2-methyl-11-methylimino-8-[(Z)-prop-1-enyl]dodeca-1,9-dien-6-amine.
| Compound Name | (9E)-4-cyclohexa-1,3-dien-1-yl-9-cyclohexa-1,5-dien-1-yl-2-methyl-11-methylimino-8-[(Z)-prop-1-enyl]dodeca-1,9-dien-6-amine |
|---|---|
| PubChem CID | 88992140 |
| Molecular Formula | C29H42N2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (9E)-4-cyclohexa-1,3-dien-1-yl-9-cyclohexa-1,5-dien-1-yl-2-methyl-11-methylimino-8-[(Z)-prop-1-enyl]dodeca-1,9-dien-6-amine |
| SMILES | C=C(C)CC(CC(N)CC(/C=C\C)/C(=C\C(C)=N\C)C1=CCCC=C1)C1=CC=CCC1 |
| InChI | InChI=1S/C29H42N2/c1-6-13-26(29(19-23(4)31-5)25-16-11-8-12-17-25)20-28(30)21-27(18-22(2)3)24-14-9-7-10-15-24/h6-7,9,11,13-14,16-17,19,26-28H,2,8,10,12,15,18,20-21,30H2,1,3-5H3/b13-6-,29-19-,31-23+ |
| InChIKey | KXZFNKDFYCNZFA-WGRBPVHZSA-N |
| XLogP | 7.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|