About 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole
6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole (PubChem CID 88992254) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole |
| PubChem CID | 88992254 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole |
| SMILES | C=Cc1nc2n(C)ccn2c1C |
| InChI | InChI=1S/C9H11N3/c1-4-8-7(2)12-6-5-11(3)9(12)10-8/h4-6H,1H2,2-3H3 |
| InChIKey | SMHJUELWMIWWCG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole?
The IUPAC name of 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole (CID 88992254) is 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole.
What is the SMILES notation for 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole?
The canonical SMILES for 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole is C=Cc1nc2n(C)ccn2c1C.
What is the InChIKey of 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole?
The InChIKey is SMHJUELWMIWWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-4-8-7(2)12-6-5-11(3)9(12)10-8/h4-6H,1H2,2-3H3.
What are the key properties of 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole?
6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole has a molecular weight of 161.21 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-1,5-dimethylimidazo[1,2-a]imidazole is sourced from PubChem (CID 88992254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).