C31H35N — CID 88992339
9-cyclohexa-1,3-dien-1-yl-3-[(2E)-6-cyclohexa-1,3-dien-1-ylhepta-2,6-dien-3-yl]-1,2,4b,8a-tetrahydrocarbazole (PubChem CID 88992339) has the molecular formula C31H35N and a molecular weight of 421.63 g/mol. Its IUPAC name is 9-cyclohexa-1,3-dien-1-yl-3-[(2E)-6-cyclohexa-1,3-dien-1-ylhepta-2,6-dien-3-yl]-1,2,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-cyclohexa-1,3-dien-1-yl-3-[(2E)-6-cyclohexa-1,3-dien-1-ylhepta-2,6-dien-3-yl]-1,2,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 88992339 |
| Molecular Formula | C31H35N |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 9-cyclohexa-1,3-dien-1-yl-3-[(2E)-6-cyclohexa-1,3-dien-1-ylhepta-2,6-dien-3-yl]-1,2,4b,8a-tetrahydrocarbazole |
| SMILES | C=C(CC/C(=C\C)C1=CC2=C(CC1)N(C1=CC=CCC1)C1C=CC=CC21)C1=CC=CCC1 |
| InChI | InChI=1S/C31H35N/c1-3-24(19-18-23(2)25-12-6-4-7-13-25)26-20-21-31-29(22-26)28-16-10-11-17-30(28)32(31)27-14-8-5-9-15-27/h3-6,8,10-12,14,16-17,22,28,30H,2,7,9,13,15,18-21H2,1H3/b24-3+ |
| InChIKey | VRJIQSLYRNKCTI-QHVLENNUSA-N |
| XLogP | 8.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |