C6H7N3S — CID 88992563
2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 88992563) has the molecular formula C6H7N3S and a molecular weight of 153.21 g/mol. Its IUPAC name is 2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 88992563 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1nn2c(C)cnc2s1 |
| InChI | InChI=1S/C6H7N3S/c1-4-3-7-6-9(4)8-5(2)10-6/h3H,1-2H3 |
| InChIKey | XMMOCHLWOSYCHT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |