C8H14N2O2S — CID 88992621
(3E,5Z)-6-amino-N-ethylhexa-1,3,5-triene-3-sulfonamide (PubChem CID 88992621) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is (3E,5Z)-6-amino-N-ethylhexa-1,3,5-triene-3-sulfonamide.
| Compound Name | (3E,5Z)-6-amino-N-ethylhexa-1,3,5-triene-3-sulfonamide |
|---|---|
| PubChem CID | 88992621 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (3E,5Z)-6-amino-N-ethylhexa-1,3,5-triene-3-sulfonamide |
| SMILES | C=C/C(=C\C=C/N)S(=O)(=O)NCC |
| InChI | InChI=1S/C8H14N2O2S/c1-3-8(6-5-7-9)13(11,12)10-4-2/h3,5-7,10H,1,4,9H2,2H3/b7-5-,8-6+ |
| InChIKey | MVOYDPRYEBRAKH-CGXWXWIYSA-N |
| XLogP | 0.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|