About 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate
2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate (PubChem CID 88992784) has the molecular formula C15H28O6
and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate.
Molecular Properties
| Compound Name | 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate |
| PubChem CID | 88992784 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate |
| SMILES | COC(C)COC(C)COC(C)COC(=O)CCC(C)=O |
| InChI | InChI=1S/C15H28O6/c1-11(16)6-7-15(17)21-10-14(4)20-9-13(3)19-8-12(2)18-5/h12-14H,6-10H2,1-5H3 |
| InChIKey | OYIXPLFEQVYSCL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate?
The IUPAC name of 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate (CID 88992784) is 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate.
What is the SMILES notation for 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate?
The canonical SMILES for 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate is COC(C)COC(C)COC(C)COC(=O)CCC(C)=O.
What is the InChIKey of 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate?
The InChIKey is OYIXPLFEQVYSCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O6/c1-11(16)6-7-15(17)21-10-14(4)20-9-13(3)19-8-12(2)18-5/h12-14H,6-10H2,1-5H3.
What are the key properties of 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate?
2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate has a molecular weight of 304.38 g/mol, XLogP of 1.74, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxypropoxy)propoxy]propyl 4-oxopentanoate is sourced from PubChem (CID 88992784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).