C18H17BClN3O2 — CID 88993037
CID 88993037 (PubChem CID 88993037) has the molecular formula C18H17BClN3O2 and a molecular weight of 353.62 g/mol.
| Compound Name | CID 88993037 |
|---|---|
| PubChem CID | 88993037 |
| Molecular Formula | C18H17BClN3O2 |
| Molecular Weight | 353.62 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(-c2noc(-c3cnc(OC(C)C)c(Cl)c3)n2)c1CC |
| InChI | InChI=1S/C18H17BClN3O2/c1-4-12-13(6-5-7-14(12)19)16-22-17(25-23-16)11-8-15(20)18(21-9-11)24-10(2)3/h5-10H,4H2,1-3H3 |
| InChIKey | QJVGGQFXKXCPCB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|