About 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine
1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine (PubChem CID 88993113) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine |
| PubChem CID | 88993113 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine |
| SMILES | FC1CCN(C2C=CC=CC2)C1 |
| InChI | InChI=1S/C10H14FN/c11-9-6-7-12(8-9)10-4-2-1-3-5-10/h1-4,9-10H,5-8H2 |
| InChIKey | KFAKHNVJKPPNJW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine?
The IUPAC name of 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine (CID 88993113) is 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine is FC1CCN(C2C=CC=CC2)C1.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine?
The InChIKey is KFAKHNVJKPPNJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c11-9-6-7-12(8-9)10-4-2-1-3-5-10/h1-4,9-10H,5-8H2.
What are the key properties of 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine?
1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine has a molecular weight of 167.23 g/mol, XLogP of 1.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-yl-3-fluoropyrrolidine is sourced from PubChem (CID 88993113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).