C14H13BrCl2FN3O2 — CID 88993181
methyl 4-[[(2E,4Z)-2-amino-3-chlorohepta-2,4,6-trienyl]amino]-3-bromo-6-chloro-5-fluoropyridine-2-carboxylate (PubChem CID 88993181) has the molecular formula C14H13BrCl2FN3O2 and a molecular weight of 425.09 g/mol. Its IUPAC name is methyl 4-[[(2E,4Z)-2-amino-3-chlorohepta-2,4,6-trienyl]amino]-3-bromo-6-chloro-5-fluoropyridine-2-carboxylate.
| Compound Name | methyl 4-[[(2E,4Z)-2-amino-3-chlorohepta-2,4,6-trienyl]amino]-3-bromo-6-chloro-5-fluoropyridine-2-carboxylate |
|---|---|
| PubChem CID | 88993181 |
| Molecular Formula | C14H13BrCl2FN3O2 |
| Molecular Weight | 425.09 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | methyl 4-[[(2E,4Z)-2-amino-3-chlorohepta-2,4,6-trienyl]amino]-3-bromo-6-chloro-5-fluoropyridine-2-carboxylate |
| SMILES | C=C/C=C\C(Cl)=C(/N)CNc1c(F)c(Cl)nc(C(=O)OC)c1Br |
| InChI | InChI=1S/C14H13BrCl2FN3O2/c1-3-4-5-7(16)8(19)6-20-11-9(15)12(14(22)23-2)21-13(17)10(11)18/h3-5H,1,6,19H2,2H3,(H,20,21)/b5-4-,8-7+ |
| InChIKey | KGEYLNXUFHCQPG-KXKKYDSASA-N |
| XLogP | 3.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.09 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|