C16H10ClF3N6O — CID 88993281
2-chloro-N-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 88993281) has the molecular formula C16H10ClF3N6O and a molecular weight of 394.74 g/mol. Its IUPAC name is 2-chloro-N-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88993281 |
| Molecular Formula | C16H10ClF3N6O |
| Molecular Weight | 394.74 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-chloro-N-(4-methyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccc(C(F)(F)F)nc2Cl)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H10ClF3N6O/c1-8-22-13(10-4-2-3-7-21-10)25-15(23-8)26-14(27)9-5-6-11(16(18,19)20)24-12(9)17/h2-7H,1H3,(H,22,23,25,26,27) |
| InChIKey | LMWWLSOBOWNYET-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|