C12H20N2 — CID 88993322
[(3Z)-4,8-dimethyl-7-methylidenenona-1,3,8-trien-3-yl]hydrazine (PubChem CID 88993322) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is [(3Z)-4,8-dimethyl-7-methylidenenona-1,3,8-trien-3-yl]hydrazine.
| Compound Name | [(3Z)-4,8-dimethyl-7-methylidenenona-1,3,8-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 88993322 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | [(3Z)-4,8-dimethyl-7-methylidenenona-1,3,8-trien-3-yl]hydrazine |
| SMILES | C=C/C(NN)=C(\C)CCC(=C)C(=C)C |
| InChI | InChI=1S/C12H20N2/c1-6-12(14-13)11(5)8-7-10(4)9(2)3/h6,14H,1-2,4,7-8,13H2,3,5H3/b12-11- |
| InChIKey | TUHVNWVJIMCTFP-QXMHVHEDSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|