C19H25NO5S — CID 8899345
ethyl 1-[2-[2-(2-methylphenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 8899345) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl 1-[2-[2-(2-methylphenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(2-methylphenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8899345 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | ethyl 1-[2-[2-(2-methylphenyl)sulfanylacetyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)CSc2ccccc2C)CC1 |
| InChI | InChI=1S/C19H25NO5S/c1-3-24-19(23)15-8-10-20(11-9-15)17(21)12-25-18(22)13-26-16-7-5-4-6-14(16)2/h4-7,15H,3,8-13H2,1-2H3 |
| InChIKey | IDRJHSYTAUXATE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |