C14H23N3 — CID 88993601
(2Z,4E)-N'-[[4-(aminomethyl)cyclohexa-1,5-dien-1-yl]methyl]hexa-2,4-diene-1,6-diamine (PubChem CID 88993601) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (2Z,4E)-N'-[[4-(aminomethyl)cyclohexa-1,5-dien-1-yl]methyl]hexa-2,4-diene-1,6-diamine.
| Compound Name | (2Z,4E)-N'-[[4-(aminomethyl)cyclohexa-1,5-dien-1-yl]methyl]hexa-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 88993601 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (2Z,4E)-N'-[[4-(aminomethyl)cyclohexa-1,5-dien-1-yl]methyl]hexa-2,4-diene-1,6-diamine |
| SMILES | NC/C=C\C=C\CNCC1=CCC(CN)C=C1 |
| InChI | InChI=1S/C14H23N3/c15-9-3-1-2-4-10-17-12-14-7-5-13(11-16)6-8-14/h1-5,7-8,13,17H,6,9-12,15-16H2/b3-1-,4-2+ |
| InChIKey | IPPRBTLNMHQKSP-HSFFGMMNSA-N |
| XLogP | 1.11 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|