C22H23N7O2S — CID 88993956
1-ethyl-3-[3-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 88993956) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-ethyl-3-[3-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-ethyl-3-[3-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 88993956 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-ethyl-3-[3-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | CCNC(=S)Nc1ccc2ncc(-c3cnn(Cc4ccc(OCCO)cc4)c3)nc2n1 |
| InChI | InChI=1S/C22H23N7O2S/c1-2-23-22(32)28-20-8-7-18-21(27-20)26-19(12-24-18)16-11-25-29(14-16)13-15-3-5-17(6-4-15)31-10-9-30/h3-8,11-12,14,30H,2,9-10,13H2,1H3,(H2,23,26,27,28,32) |
| InChIKey | OLISHYQNXXQROV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|