About 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one
4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one (PubChem CID 88994002) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 88994002 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one |
| SMILES | C=C(O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H6N2O2/c1-3(8)4-2-6-5(9)7-4/h2,8H,1H2,(H2,6,7,9) |
| InChIKey | KTWONMARPWOXSQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one (CID 88994002) is 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one is C=C(O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one?
The InChIKey is KTWONMARPWOXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c1-3(8)4-2-6-5(9)7-4/h2,8H,1H2,(H2,6,7,9).
What are the key properties of 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one?
4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one has a molecular weight of 126.11 g/mol, XLogP of 0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-hydroxyethenyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 88994002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).