C30H27ClFN5O2 — CID 88994011
6-chloro-2-[1-(4-fluorophenoxy)ethenyl]-1-[4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 88994011) has the molecular formula C30H27ClFN5O2 and a molecular weight of 544.03 g/mol. Its IUPAC name is 6-chloro-2-[1-(4-fluorophenoxy)ethenyl]-1-[4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-chloro-2-[1-(4-fluorophenoxy)ethenyl]-1-[4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 88994011 |
| Molecular Formula | C30H27ClFN5O2 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 6-chloro-2-[1-(4-fluorophenoxy)ethenyl]-1-[4-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=C(Oc1ccc(F)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCCn2cncn2)cc1 |
| InChI | InChI=1S/C30H27ClFN5O2/c1-20(39-25-10-6-23(32)7-11-25)37-15-13-26-27-17-22(31)5-12-28(27)35-29(26)30(37)21-3-8-24(9-4-21)38-16-2-14-36-19-33-18-34-36/h3-12,17-19,30,35H,1-2,13-16H2 |
| InChIKey | HBELEEMATVQPJX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|