C31H31Cl2N5O4 — CID 88994013
(4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88994013) has the molecular formula C31H31Cl2N5O4 and a molecular weight of 608.53 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88994013 |
| Molecular Formula | C31H31Cl2N5O4 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[3-methoxy-4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1cc(C2c3[nH]c4c(c3CCN2C(=O)Oc2ccc(Cl)cc2)=CC(Cl)CC=4)ccc1OCCCCn1cncn1 |
| InChI | InChI=1S/C31H31Cl2N5O4/c1-40-28-16-20(4-11-27(28)41-15-3-2-13-37-19-34-18-35-37)30-29-24(25-17-22(33)7-10-26(25)36-29)12-14-38(30)31(39)42-23-8-5-21(32)6-9-23/h4-6,8-11,16-19,22,30,36H,2-3,7,12-15H2,1H3 |
| InChIKey | MPQDDTFUXBTNDA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|