C32H32ClFN4O3 — CID 88994269
(4-fluorophenyl) 1-[4-[2-(4-amino-3-methyl-2H-pyridin-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88994269) has the molecular formula C32H32ClFN4O3 and a molecular weight of 575.08 g/mol. Its IUPAC name is (4-fluorophenyl) 1-[4-[2-(4-amino-3-methyl-2H-pyridin-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 1-[4-[2-(4-amino-3-methyl-2H-pyridin-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88994269 |
| Molecular Formula | C32H32ClFN4O3 |
| Molecular Weight | 575.08 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (4-fluorophenyl) 1-[4-[2-(4-amino-3-methyl-2H-pyridin-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1=C(N)C=CN(CCOc2ccc(C3c4[nH]c5c(c4CCN3C(=O)Oc3ccc(F)cc3)=CC(Cl)CC=5)cc2)C1 |
| InChI | InChI=1S/C32H32ClFN4O3/c1-20-19-37(14-13-28(20)35)16-17-40-24-7-2-21(3-8-24)31-30-26(27-18-22(33)4-11-29(27)36-30)12-15-38(31)32(39)41-25-9-5-23(34)6-10-25/h2-3,5-11,13-14,18,22,31,36H,4,12,15-17,19,35H2,1H3 |
| InChIKey | OONXLVTXMPPTDB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|