C35H37F3N6S — CID 88994735
5-[3-[1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]ethenyl]phenyl]-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 88994735) has the molecular formula C35H37F3N6S and a molecular weight of 630.78 g/mol. Its IUPAC name is 5-[3-[1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]ethenyl]phenyl]-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 5-[3-[1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]ethenyl]phenyl]-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 88994735 |
| Molecular Formula | C35H37F3N6S |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 5-[3-[1-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)anilino]ethenyl]phenyl]-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | C=C/C=C\C=C(/C)Nc1nc2ccc(-c3cccc(C(=C)Nc4ccc(CN5CCN(CC)CC5)c(C(F)(F)F)c4)c3)nc2s1 |
| InChI | InChI=1S/C35H37F3N6S/c1-5-7-8-10-24(3)39-34-42-32-16-15-31(41-33(32)45-34)27-12-9-11-26(21-27)25(4)40-29-14-13-28(30(22-29)35(36,37)38)23-44-19-17-43(6-2)18-20-44/h5,7-16,21-22,40H,1,4,6,17-20,23H2,2-3H3,(H,39,42)/b8-7-,24-10+ |
| InChIKey | KOFTYXBOMHJCCK-RZKKRMSFSA-N |
| XLogP | 8.66 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|