C27H34FN5O6 — CID 88994858
2-amino-4-[(1R)-1-[[(6R)-3-(ethoxyamino)-6-[(5-fluoro-2-methoxyphenyl)methyl]-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]butyl]benzoic acid (PubChem CID 88994858) has the molecular formula C27H34FN5O6 and a molecular weight of 543.60 g/mol. Its IUPAC name is 2-amino-4-[(1R)-1-[[(6R)-3-(ethoxyamino)-6-[(5-fluoro-2-methoxyphenyl)methyl]-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]butyl]benzoic acid.
| Compound Name | 2-amino-4-[(1R)-1-[[(6R)-3-(ethoxyamino)-6-[(5-fluoro-2-methoxyphenyl)methyl]-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]butyl]benzoic acid |
|---|---|
| PubChem CID | 88994858 |
| Molecular Formula | C27H34FN5O6 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 2-amino-4-[(1R)-1-[[(6R)-3-(ethoxyamino)-6-[(5-fluoro-2-methoxyphenyl)methyl]-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]butyl]benzoic acid |
| SMILES | CCC[C@@H](NC(=O)N1CC(NOCC)=NC[C@@H](Cc2cc(F)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C27H34FN5O6/c1-4-6-22(16-7-9-20(26(35)36)21(29)13-16)31-27(37)33-15-24(32-39-5-2)30-14-18(25(33)34)11-17-12-19(28)8-10-23(17)38-3/h7-10,12-13,18,22H,4-6,11,14-15,29H2,1-3H3,(H,30,32)(H,31,37)(H,35,36)/t18-,22-/m1/s1 |
| InChIKey | MDBSJWOREXSLIW-XMSQKQJNSA-N |
| XLogP | 3.31 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|