C28H28ClFN2O3 — CID 88995027
[(3S)-4-fluoro-3-methylcyclohexa-1,5-dien-1-yl] 6-chloro-1-(4-prop-2-enoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88995027) has the molecular formula C28H28ClFN2O3 and a molecular weight of 494.99 g/mol. Its IUPAC name is [(3S)-4-fluoro-3-methylcyclohexa-1,5-dien-1-yl] 6-chloro-1-(4-prop-2-enoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | [(3S)-4-fluoro-3-methylcyclohexa-1,5-dien-1-yl] 6-chloro-1-(4-prop-2-enoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88995027 |
| Molecular Formula | C28H28ClFN2O3 |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [(3S)-4-fluoro-3-methylcyclohexa-1,5-dien-1-yl] 6-chloro-1-(4-prop-2-enoxyphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | C=CCOc1ccc(C2c3[nH]c4c(c3CCN2C(=O)OC2=C[C@H](C)C(F)C=C2)=CC(Cl)CC=4)cc1 |
| InChI | InChI=1S/C28H28ClFN2O3/c1-3-14-34-20-7-4-18(5-8-20)27-26-22(23-16-19(29)6-11-25(23)31-26)12-13-32(27)28(33)35-21-9-10-24(30)17(2)15-21/h3-5,7-11,15-17,19,24,27,31H,1,6,12-14H2,2H3/t17-,19?,24?,27?/m0/s1 |
| InChIKey | RBXNLMGSFXZLPO-AWTSRJKKSA-N |
| XLogP | 4.66 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|